C28H26F3N3O2S — CID 3470973
N-[2-(N-ethylanilino)ethyl]-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide (PubChem CID 3470973) has the molecular formula C28H26F3N3O2S and a molecular weight of 525.60 g/mol. Its IUPAC name is N-[2-(N-ethylanilino)ethyl]-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-[2-(N-ethylanilino)ethyl]-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 3470973 |
| Molecular Formula | C28H26F3N3O2S |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-[2-(N-ethylanilino)ethyl]-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
| SMILES | CCN(CCNC(=O)CN1C(=O)C(=Cc2ccc(C(F)(F)F)cc2)Sc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C28H26F3N3O2S/c1-2-33(22-8-4-3-5-9-22)17-16-32-26(35)19-34-23-10-6-7-11-24(23)37-25(27(34)36)18-20-12-14-21(15-13-20)28(29,30)31/h3-15,18H,2,16-17,19H2,1H3,(H,32,35) |
| InChIKey | PTTOZQNQWXXGIS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|