C19H15F3N2O2S — CID 46251059
N-methyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide (PubChem CID 46251059) has the molecular formula C19H15F3N2O2S and a molecular weight of 392.40 g/mol. Its IUPAC name is N-methyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-methyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46251059 |
| Molecular Formula | C19H15F3N2O2S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-methyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
| SMILES | CNC(=O)CN1C(=O)/C(=C\c2ccc(C(F)(F)F)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C19H15F3N2O2S/c1-23-17(25)11-24-14-4-2-3-5-15(14)27-16(18(24)26)10-12-6-8-13(9-7-12)19(20,21)22/h2-10H,11H2,1H3,(H,23,25)/b16-10+ |
| InChIKey | AXSVJVRYRVIJNE-MHWRWJLKSA-N |
| XLogP | 3.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|