C24H28ClN3O2S — CID 46372678
N-[2-[butyl(methyl)amino]ethyl]-2-[(2Z)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide (PubChem CID 46372678) has the molecular formula C24H28ClN3O2S and a molecular weight of 458.03 g/mol. Its IUPAC name is N-[2-[butyl(methyl)amino]ethyl]-2-[(2Z)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-[2-[butyl(methyl)amino]ethyl]-2-[(2Z)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46372678 |
| Molecular Formula | C24H28ClN3O2S |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[2-[butyl(methyl)amino]ethyl]-2-[(2Z)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
| SMILES | CCCCN(C)CCNC(=O)CN1C(=O)/C(=C/c2cccc(Cl)c2)Sc2ccccc21 |
| InChI | InChI=1S/C24H28ClN3O2S/c1-3-4-13-27(2)14-12-26-23(29)17-28-20-10-5-6-11-21(20)31-22(24(28)30)16-18-8-7-9-19(25)15-18/h5-11,15-16H,3-4,12-14,17H2,1-2H3,(H,26,29)/b22-16- |
| InChIKey | VUOFIKPRWPXIFV-JWGURIENSA-N |
| XLogP | 4.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|