C22H23BrN2O2S — CID 46372937
2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylbutyl)acetamide (PubChem CID 46372937) has the molecular formula C22H23BrN2O2S and a molecular weight of 459.41 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 46372937 |
| Molecular Formula | C22H23BrN2O2S |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CN1C(=O)/C(=C\c2cccc(Br)c2)Sc2ccccc21 |
| InChI | InChI=1S/C22H23BrN2O2S/c1-15(2)10-11-24-21(26)14-25-18-8-3-4-9-19(18)28-20(22(25)27)13-16-6-5-7-17(23)12-16/h3-9,12-13,15H,10-11,14H2,1-2H3,(H,24,26)/b20-13+ |
| InChIKey | GTXWIPZTZCUALE-DEDYPNTBSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|