C26H23BrN2O2S — CID 46372947
2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[2-(3-methylphenyl)ethyl]acetamide (PubChem CID 46372947) has the molecular formula C26H23BrN2O2S and a molecular weight of 507.45 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[2-(3-methylphenyl)ethyl]acetamide.
| Compound Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[2-(3-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 46372947 |
| Molecular Formula | C26H23BrN2O2S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[2-(3-methylphenyl)ethyl]acetamide |
| SMILES | Cc1cccc(CCNC(=O)CN2C(=O)/C(=C\c3cccc(Br)c3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C26H23BrN2O2S/c1-18-6-4-7-19(14-18)12-13-28-25(30)17-29-22-10-2-3-11-23(22)32-24(26(29)31)16-20-8-5-9-21(27)15-20/h2-11,14-16H,12-13,17H2,1H3,(H,28,30)/b24-16+ |
| InChIKey | UADNMONTYMCMHH-LFVJCYFKSA-N |
| XLogP | 5.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|