C25H21FN2O2S — CID 46250905
2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(2-phenylethyl)acetamide (PubChem CID 46250905) has the molecular formula C25H21FN2O2S and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 46250905 |
| Molecular Formula | C25H21FN2O2S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccccc2F)Sc2ccccc21)NCCc1ccccc1 |
| InChI | InChI=1S/C25H21FN2O2S/c26-20-11-5-4-10-19(20)16-23-25(30)28(21-12-6-7-13-22(21)31-23)17-24(29)27-15-14-18-8-2-1-3-9-18/h1-13,16H,14-15,17H2,(H,27,29)/b23-16- |
| InChIKey | RNCXLRPOFDJWDB-KQWNVCNZSA-N |
| XLogP | 4.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|