C20H18N2O3S — CID 164623461
2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-phenylethyl)acetamide (PubChem CID 164623461) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 164623461 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccccc2)C1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H18N2O3S/c23-18(21-12-11-15-7-3-1-4-8-15)14-22-19(24)17(26-20(22)25)13-16-9-5-2-6-10-16/h1-10,13H,11-12,14H2,(H,21,23)/b17-13- |
| InChIKey | HLZOEHKDXFUDBD-LGMDPLHJSA-N |
| XLogP | 3.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|