C15H14N2O4S — CID 155537071
2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-prop-2-enoxyacetamide (PubChem CID 155537071) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-prop-2-enoxyacetamide.
| Compound Name | 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-prop-2-enoxyacetamide |
|---|---|
| PubChem CID | 155537071 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-prop-2-enoxyacetamide |
| SMILES | C=CCONC(=O)CN1C(=O)S/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C15H14N2O4S/c1-2-8-21-16-13(18)10-17-14(19)12(22-15(17)20)9-11-6-4-3-5-7-11/h2-7,9H,1,8,10H2,(H,16,18)/b12-9- |
| InChIKey | PYNUTFLGXBJOMQ-XFXZXTDPSA-N |
| XLogP | 1.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|