C27H32FN3O2S — CID 92657318
N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide (PubChem CID 92657318) has the molecular formula C27H32FN3O2S and a molecular weight of 481.64 g/mol. Its IUPAC name is N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 92657318 |
| Molecular Formula | C27H32FN3O2S |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
| SMILES | C[C@@H]1C[C@H](C)CN(CCCNC(=O)CN2C(=O)/C(=C/c3ccccc3F)Sc3ccccc32)C1 |
| InChI | InChI=1S/C27H32FN3O2S/c1-19-14-20(2)17-30(16-19)13-7-12-29-26(32)18-31-23-10-5-6-11-24(23)34-25(27(31)33)15-21-8-3-4-9-22(21)28/h3-6,8-11,15,19-20H,7,12-14,16-18H2,1-2H3,(H,29,32)/b25-15-/t19-,20+ |
| InChIKey | HXNVGLQVDKZJJA-CSGQPYJXSA-N |
| XLogP | 4.79 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|