C25H29ClN4O2S — CID 46250858
2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide (PubChem CID 46250858) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 46250858 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
| SMILES | CN1CCN(CCCNC(=O)CN2C(=O)/C(=C\c3cccc(Cl)c3)Sc3ccccc32)CC1 |
| InChI | InChI=1S/C25H29ClN4O2S/c1-28-12-14-29(15-13-28)11-5-10-27-24(31)18-30-21-8-2-3-9-22(21)33-23(25(30)32)17-19-6-4-7-20(26)16-19/h2-4,6-9,16-17H,5,10-15,18H2,1H3,(H,27,31)/b23-17+ |
| InChIKey | BREFLIVLZLFJOI-HAVVHWLPSA-N |
| XLogP | 3.57 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|