C24H25ClN2O2S — CID 92657290
2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1R,2S)-2-methylcyclohexyl]acetamide (PubChem CID 92657290) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1R,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 92657290 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)CN1C(=O)/C(=C\c2cccc(Cl)c2)Sc2ccccc21 |
| InChI | InChI=1S/C24H25ClN2O2S/c1-16-7-2-3-10-19(16)26-23(28)15-27-20-11-4-5-12-21(20)30-22(24(27)29)14-17-8-6-9-18(25)13-17/h4-6,8-9,11-14,16,19H,2-3,7,10,15H2,1H3,(H,26,28)/b22-14+/t16-,19+/m0/s1 |
| InChIKey | HFNVOTMVWFZCSF-INJKSQGZSA-N |
| XLogP | 5.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|