C28H26ClN3O3S — CID 4133898
2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one (PubChem CID 4133898) has the molecular formula C28H26ClN3O3S and a molecular weight of 520.05 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one.
| Compound Name | 2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4133898 |
| Molecular Formula | C28H26ClN3O3S |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
| SMILES | COc1ccccc1N1CCN(C(=O)CN2C(=O)C(=Cc3cccc(Cl)c3)Sc3ccccc32)CC1 |
| InChI | InChI=1S/C28H26ClN3O3S/c1-35-24-11-4-2-9-22(24)30-13-15-31(16-14-30)27(33)19-32-23-10-3-5-12-25(23)36-26(28(32)34)18-20-7-6-8-21(29)17-20/h2-12,17-18H,13-16,19H2,1H3 |
| InChIKey | VHBFMJLJHCDVCW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|