C26H23ClN4O2S — CID 46251030
(2E)-2-[(2-chlorophenyl)methylidene]-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-1,4-benzothiazin-3-one (PubChem CID 46251030) has the molecular formula C26H23ClN4O2S and a molecular weight of 491.02 g/mol. Its IUPAC name is (2E)-2-[(2-chlorophenyl)methylidene]-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-[(2-chlorophenyl)methylidene]-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46251030 |
| Molecular Formula | C26H23ClN4O2S |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (2E)-2-[(2-chlorophenyl)methylidene]-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-1,4-benzothiazin-3-one |
| SMILES | O=C(CN1C(=O)/C(=C\c2ccccc2Cl)Sc2ccccc21)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C26H23ClN4O2S/c27-20-8-2-1-7-19(20)17-23-26(33)31(21-9-3-4-10-22(21)34-23)18-25(32)30-15-13-29(14-16-30)24-11-5-6-12-28-24/h1-12,17H,13-16,18H2/b23-17+ |
| InChIKey | WNGVEACRXGEKNJ-HAVVHWLPSA-N |
| XLogP | 4.56 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|