C25H21ClN4O2S — CID 6000737
(2E)-2-[(2-chlorophenyl)methylidene]-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one (PubChem CID 6000737) has the molecular formula C25H21ClN4O2S and a molecular weight of 476.99 g/mol. Its IUPAC name is (2E)-2-[(2-chlorophenyl)methylidene]-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-[(2-chlorophenyl)methylidene]-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 6000737 |
| Molecular Formula | C25H21ClN4O2S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (2E)-2-[(2-chlorophenyl)methylidene]-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2cc(C(=O)N3CCN(c4ccccn4)CC3)ccc2S/C1=C/c1ccccc1Cl |
| InChI | InChI=1S/C25H21ClN4O2S/c26-19-6-2-1-5-17(19)16-22-24(31)28-20-15-18(8-9-21(20)33-22)25(32)30-13-11-29(12-14-30)23-7-3-4-10-27-23/h1-10,15-16H,11-14H2,(H,28,31)/b22-16+ |
| InChIKey | CPMUXHWPQRPBBA-CJLVFECKSA-N |
| XLogP | 4.78 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|