C27H23ClFN3O2S — CID 46250452
(2Z)-2-[(2-chlorophenyl)methylidene]-6-[4-(2-fluorophenyl)piperazine-1-carbonyl]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 46250452) has the molecular formula C27H23ClFN3O2S and a molecular weight of 508.02 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-6-[4-(2-fluorophenyl)piperazine-1-carbonyl]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-[4-(2-fluorophenyl)piperazine-1-carbonyl]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46250452 |
| Molecular Formula | C27H23ClFN3O2S |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-[4-(2-fluorophenyl)piperazine-1-carbonyl]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)/C(=C/c2ccccc2Cl)Sc2ccc(C(=O)N3CCN(c4ccccc4F)CC3)cc21 |
| InChI | InChI=1S/C27H23ClFN3O2S/c1-30-23-16-19(26(33)32-14-12-31(13-15-32)22-9-5-4-8-21(22)29)10-11-24(23)35-25(27(30)34)17-18-6-2-3-7-20(18)28/h2-11,16-17H,12-15H2,1H3/b25-17- |
| InChIKey | IERHDMOLRJXAGX-UQQQWYQISA-N |
| XLogP | 5.55 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|