C22H21FN2O2S — CID 46250243
(2Z)-2-[(2-fluorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one (PubChem CID 46250243) has the molecular formula C22H21FN2O2S and a molecular weight of 396.49 g/mol. Its IUPAC name is (2Z)-2-[(2-fluorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(2-fluorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46250243 |
| Molecular Formula | C22H21FN2O2S |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (2Z)-2-[(2-fluorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)/C(=C/c2ccccc2F)Sc2ccc(C(=O)N3CCCCC3)cc21 |
| InChI | InChI=1S/C22H21FN2O2S/c1-24-18-13-16(21(26)25-11-5-2-6-12-25)9-10-19(18)28-20(22(24)27)14-15-7-3-4-8-17(15)23/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3/b20-14- |
| InChIKey | DOMJHSBUYAWGCQ-ZHZULCJRSA-N |
| XLogP | 4.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|