C25H25ClN2O4S — CID 4638893
ethyl 1-[2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl]piperidine-4-carboxylate (PubChem CID 4638893) has the molecular formula C25H25ClN2O4S and a molecular weight of 485.01 g/mol. Its IUPAC name is ethyl 1-[2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4638893 |
| Molecular Formula | C25H25ClN2O4S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | ethyl 1-[2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc3c(c2)N(C)C(=O)C(=Cc2ccccc2Cl)S3)CC1 |
| InChI | InChI=1S/C25H25ClN2O4S/c1-3-32-25(31)16-10-12-28(13-11-16)23(29)18-8-9-21-20(14-18)27(2)24(30)22(33-21)15-17-6-4-5-7-19(17)26/h4-9,14-16H,3,10-13H2,1-2H3 |
| InChIKey | IPXVOONOAFYORK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|