C22H19F3N2O2S — CID 46250538
(2Z)-4-methyl-6-(pyrrolidine-1-carbonyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-3-one (PubChem CID 46250538) has the molecular formula C22H19F3N2O2S and a molecular weight of 432.47 g/mol. Its IUPAC name is (2Z)-4-methyl-6-(pyrrolidine-1-carbonyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-4-methyl-6-(pyrrolidine-1-carbonyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46250538 |
| Molecular Formula | C22H19F3N2O2S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (2Z)-4-methyl-6-(pyrrolidine-1-carbonyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)/C(=C/c2ccc(C(F)(F)F)cc2)Sc2ccc(C(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C22H19F3N2O2S/c1-26-17-13-15(20(28)27-10-2-3-11-27)6-9-18(17)30-19(21(26)29)12-14-4-7-16(8-5-14)22(23,24)25/h4-9,12-13H,2-3,10-11H2,1H3/b19-12- |
| InChIKey | IPTSLVRFMZAGIE-UNOMPAQXSA-N |
| XLogP | 5.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|