C30H29F3N2O3S — CID 46373796
(2E)-N-[1-(4-butoxyphenyl)ethyl]-4-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazine-6-carboxamide (PubChem CID 46373796) has the molecular formula C30H29F3N2O3S and a molecular weight of 554.63 g/mol. Its IUPAC name is (2E)-N-[1-(4-butoxyphenyl)ethyl]-4-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-[1-(4-butoxyphenyl)ethyl]-4-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46373796 |
| Molecular Formula | C30H29F3N2O3S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | (2E)-N-[1-(4-butoxyphenyl)ethyl]-4-methyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazine-6-carboxamide |
| SMILES | CCCCOc1ccc(C(C)NC(=O)c2ccc3c(c2)N(C)C(=O)/C(=C\c2ccc(C(F)(F)F)cc2)S3)cc1 |
| InChI | InChI=1S/C30H29F3N2O3S/c1-4-5-16-38-24-13-8-21(9-14-24)19(2)34-28(36)22-10-15-26-25(18-22)35(3)29(37)27(39-26)17-20-6-11-23(12-7-20)30(31,32)33/h6-15,17-19H,4-5,16H2,1-3H3,(H,34,36)/b27-17+ |
| InChIKey | ZOVDNGPMBNWXCK-WPWMEQJKSA-N |
| XLogP | 7.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|