C30H32N2O4S — CID 92697016
(2E)-N-[(1R)-1-(4-butoxyphenyl)ethyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 92697016) has the molecular formula C30H32N2O4S and a molecular weight of 516.66 g/mol. Its IUPAC name is (2E)-N-[(1R)-1-(4-butoxyphenyl)ethyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-[(1R)-1-(4-butoxyphenyl)ethyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92697016 |
| Molecular Formula | C30H32N2O4S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | (2E)-N-[(1R)-1-(4-butoxyphenyl)ethyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | CCCCOc1ccc([C@@H](C)NC(=O)c2ccc3c(c2)N(C)C(=O)/C(=C\c2ccc(OC)cc2)S3)cc1 |
| InChI | InChI=1S/C30H32N2O4S/c1-5-6-17-36-25-14-9-22(10-15-25)20(2)31-29(33)23-11-16-27-26(19-23)32(3)30(34)28(37-27)18-21-7-12-24(35-4)13-8-21/h7-16,18-20H,5-6,17H2,1-4H3,(H,31,33)/b28-18+/t20-/m1/s1 |
| InChIKey | PYELXRLHVMTUES-CLCAUBNZSA-N |
| XLogP | 6.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|