C29H39N3O3S — CID 46250115
(2Z)-N-[3-[bis(2-methylpropyl)amino]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 46250115) has the molecular formula C29H39N3O3S and a molecular weight of 509.72 g/mol. Its IUPAC name is (2Z)-N-[3-[bis(2-methylpropyl)amino]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-N-[3-[bis(2-methylpropyl)amino]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46250115 |
| Molecular Formula | C29H39N3O3S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | (2Z)-N-[3-[bis(2-methylpropyl)amino]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(/C=C2\Sc3ccc(C(=O)NCCCN(CC(C)C)CC(C)C)cc3N(C)C2=O)cc1 |
| InChI | InChI=1S/C29H39N3O3S/c1-20(2)18-32(19-21(3)4)15-7-14-30-28(33)23-10-13-26-25(17-23)31(5)29(34)27(36-26)16-22-8-11-24(35-6)12-9-22/h8-13,16-17,20-21H,7,14-15,18-19H2,1-6H3,(H,30,33)/b27-16- |
| InChIKey | XYMNTQHTHOOODE-YUMHPJSZSA-N |
| XLogP | 5.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|