C31H33ClN4O3S — CID 46250110
(2Z)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 46250110) has the molecular formula C31H33ClN4O3S and a molecular weight of 577.15 g/mol. Its IUPAC name is (2Z)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46250110 |
| Molecular Formula | C31H33ClN4O3S |
| Molecular Weight | 577.15 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | (2Z)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(/C=C2\Sc3ccc(C(=O)NCCCN4CCN(c5cccc(Cl)c5)CC4)cc3N(C)C2=O)cc1 |
| InChI | InChI=1S/C31H33ClN4O3S/c1-34-27-20-23(9-12-28(27)40-29(31(34)38)19-22-7-10-26(39-2)11-8-22)30(37)33-13-4-14-35-15-17-36(18-16-35)25-6-3-5-24(32)21-25/h3,5-12,19-21H,4,13-18H2,1-2H3,(H,33,37)/b29-19- |
| InChIKey | WFXMFBGZSSHYHB-CEUNXORHSA-N |
| XLogP | 5.40 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.15 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|