C24H27ClN2O2S2 — CID 46250229
(2Z)-N-(3-butylsulfanylpropyl)-2-[(3-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 46250229) has the molecular formula C24H27ClN2O2S2 and a molecular weight of 475.08 g/mol. Its IUPAC name is (2Z)-N-(3-butylsulfanylpropyl)-2-[(3-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-N-(3-butylsulfanylpropyl)-2-[(3-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46250229 |
| Molecular Formula | C24H27ClN2O2S2 |
| Molecular Weight | 475.08 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (2Z)-N-(3-butylsulfanylpropyl)-2-[(3-chlorophenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | CCCCSCCCNC(=O)c1ccc2c(c1)N(C)C(=O)/C(=C/c1cccc(Cl)c1)S2 |
| InChI | InChI=1S/C24H27ClN2O2S2/c1-3-4-12-30-13-6-11-26-23(28)18-9-10-21-20(16-18)27(2)24(29)22(31-21)15-17-7-5-8-19(25)14-17/h5,7-10,14-16H,3-4,6,11-13H2,1-2H3,(H,26,28)/b22-15- |
| InChIKey | OJUWABGAWJIKSX-JCMHNJIXSA-N |
| XLogP | 6.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.08 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|