C27H32ClN3O2S — CID 92657102
(2Z)-2-[(3-chlorophenyl)methylidene]-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 92657102) has the molecular formula C27H32ClN3O2S and a molecular weight of 498.09 g/mol. Its IUPAC name is (2Z)-2-[(3-chlorophenyl)methylidene]-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-[(3-chlorophenyl)methylidene]-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92657102 |
| Molecular Formula | C27H32ClN3O2S |
| Molecular Weight | 498.09 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (2Z)-2-[(3-chlorophenyl)methylidene]-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | C[C@@H]1C[C@H](C)CN(CCCNC(=O)c2ccc3c(c2)N(C)C(=O)/C(=C/c2cccc(Cl)c2)S3)C1 |
| InChI | InChI=1S/C27H32ClN3O2S/c1-18-12-19(2)17-31(16-18)11-5-10-29-26(32)21-8-9-24-23(15-21)30(3)27(33)25(34-24)14-20-6-4-7-22(28)13-20/h4,6-9,13-15,18-19H,5,10-12,16-17H2,1-3H3,(H,29,32)/b25-14-/t18-,19+ |
| InChIKey | KUZDAWGVCLCHET-ZOLBUAMYSA-N |
| XLogP | 5.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.09 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|