C28H35N3O2S — CID 5047171
N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 5047171) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 5047171 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(C=C2Sc3ccc(C(=O)NCCCN4C(C)CCCC4C)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C28H35N3O2S/c1-19-8-5-11-22(16-19)17-26-28(33)30(4)24-18-23(12-13-25(24)34-26)27(32)29-14-7-15-31-20(2)9-6-10-21(31)3/h5,8,11-13,16-18,20-21H,6-7,9-10,14-15H2,1-4H3,(H,29,32) |
| InChIKey | YEWYXWMDBOWRKU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|