C35H41N3O2S — CID 98218370
4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]benzamide (PubChem CID 98218370) has the molecular formula C35H41N3O2S and a molecular weight of 567.80 g/mol. Its IUPAC name is 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 98218370 |
| Molecular Formula | C35H41N3O2S |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]benzamide |
| SMILES | Cc1ccc(C)c(CN2C(=O)/C(=C/c3ccc(C(=O)NCCCN4[C@H](C)CCC[C@@H]4C)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C35H41N3O2S/c1-24-13-14-25(2)30(21-24)23-38-31-11-5-6-12-32(31)41-33(35(38)40)22-28-15-17-29(18-16-28)34(39)36-19-8-20-37-26(3)9-7-10-27(37)4/h5-6,11-18,21-22,26-27H,7-10,19-20,23H2,1-4H3,(H,36,39)/b33-22-/t26-,27+ |
| InChIKey | NIHYNGUITOSPAO-ZQVBFGMRSA-N |
| XLogP | 7.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|