C23H24N2O4S — CID 92505074
(2Z)-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]-1,4-benzothiazine-6-carboxamide (PubChem CID 92505074) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is (2Z)-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92505074 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-4-methyl-3-oxo-N-[[(2R)-oxolan-2-yl]methyl]-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(/C=C2\Sc3ccc(C(=O)NC[C@H]4CCCO4)cc3N(C)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-25-19-13-16(22(26)24-14-18-4-3-11-29-18)7-10-20(19)30-21(23(25)27)12-15-5-8-17(28-2)9-6-15/h5-10,12-13,18H,3-4,11,14H2,1-2H3,(H,24,26)/b21-12-/t18-/m1/s1 |
| InChIKey | NWUNURGLQOWCMF-UZQMFHLOSA-N |
| XLogP | 3.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|