C34H40ClN3O2S — CID 46374368
N-[3-[bis(2-methylpropyl)amino]propyl]-4-[(E)-[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 46374368) has the molecular formula C34H40ClN3O2S and a molecular weight of 590.23 g/mol. Its IUPAC name is N-[3-[bis(2-methylpropyl)amino]propyl]-4-[(E)-[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[3-[bis(2-methylpropyl)amino]propyl]-4-[(E)-[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46374368 |
| Molecular Formula | C34H40ClN3O2S |
| Molecular Weight | 590.23 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | N-[3-[bis(2-methylpropyl)amino]propyl]-4-[(E)-[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | CC(C)CN(CCCNC(=O)c1ccc(/C=C2/Sc3ccccc3N(Cc3cccc(Cl)c3)C2=O)cc1)CC(C)C |
| InChI | InChI=1S/C34H40ClN3O2S/c1-24(2)21-37(22-25(3)4)18-8-17-36-33(39)28-15-13-26(14-16-28)20-32-34(40)38(23-27-9-7-10-29(35)19-27)30-11-5-6-12-31(30)41-32/h5-7,9-16,19-20,24-25H,8,17-18,21-23H2,1-4H3,(H,36,39)/b32-20+ |
| InChIKey | CNZMUXWIWRYJQS-UZWMFBFFSA-N |
| XLogP | 7.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.23 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|