C28H27ClN3O2S+ — CID 4160148
4-[(3-chlorophenyl)methyl]-2-[[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one (PubChem CID 4160148) has the molecular formula C28H27ClN3O2S+ and a molecular weight of 505.06 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-2-[[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one.
| Compound Name | 4-[(3-chlorophenyl)methyl]-2-[[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4160148 |
| Molecular Formula | C28H27ClN3O2S+ |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-2-[[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
| SMILES | C[NH+]1CCN(C(=O)c2ccc(C=C3Sc4ccccc4N(Cc4cccc(Cl)c4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C28H26ClN3O2S/c1-30-13-15-31(16-14-30)27(33)22-11-9-20(10-12-22)18-26-28(34)32(19-21-5-4-6-23(29)17-21)24-7-2-3-8-25(24)35-26/h2-12,17-18H,13-16,19H2,1H3/p+1 |
| InChIKey | BCQINPXEIYYQCM-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|