C31H23ClN2O4S — CID 3566891
N-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 3566891) has the molecular formula C31H23ClN2O4S and a molecular weight of 555.06 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 3566891 |
| Molecular Formula | C31H23ClN2O4S |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[[4-[(3-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc(C=C2Sc3ccccc3N(Cc3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C31H23ClN2O4S/c32-24-5-3-4-22(14-24)18-34-25-6-1-2-7-28(25)39-29(31(34)36)16-20-8-11-23(12-9-20)30(35)33-17-21-10-13-26-27(15-21)38-19-37-26/h1-16H,17-19H2,(H,33,35) |
| InChIKey | QDSKFQUHNMAHJG-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|