C29H28N2O2S — CID 4070495
4-[(3-methylphenyl)methyl]-2-[[4-(piperidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one (PubChem CID 4070495) has the molecular formula C29H28N2O2S and a molecular weight of 468.62 g/mol. Its IUPAC name is 4-[(3-methylphenyl)methyl]-2-[[4-(piperidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one.
| Compound Name | 4-[(3-methylphenyl)methyl]-2-[[4-(piperidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4070495 |
| Molecular Formula | C29H28N2O2S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 4-[(3-methylphenyl)methyl]-2-[[4-(piperidine-1-carbonyl)phenyl]methylidene]-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(CN2C(=O)C(=Cc3ccc(C(=O)N4CCCCC4)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C29H28N2O2S/c1-21-8-7-9-23(18-21)20-31-25-10-3-4-11-26(25)34-27(29(31)33)19-22-12-14-24(15-13-22)28(32)30-16-5-2-6-17-30/h3-4,7-15,18-19H,2,5-6,16-17,20H2,1H3 |
| InChIKey | SNUJRYJTPGWTDD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|