C36H35N3O2S — CID 3264377
N-(1-benzylpiperidin-4-yl)-4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 3264377) has the molecular formula C36H35N3O2S and a molecular weight of 573.76 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 3264377 |
| Molecular Formula | C36H35N3O2S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-[[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | Cc1cccc(CN2C(=O)C(=Cc3ccc(C(=O)NC4CCN(Cc5ccccc5)CC4)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C36H35N3O2S/c1-26-8-7-11-29(22-26)25-39-32-12-5-6-13-33(32)42-34(36(39)41)23-27-14-16-30(17-15-27)35(40)37-31-18-20-38(21-19-31)24-28-9-3-2-4-10-28/h2-17,22-23,31H,18-21,24-25H2,1H3,(H,37,40) |
| InChIKey | OPCNUAUQIIIFHX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|