C37H37FN4O2S — CID 46373988
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 46373988) has the molecular formula C37H37FN4O2S and a molecular weight of 620.79 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46373988 |
| Molecular Formula | C37H37FN4O2S |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-4-[(E)-[4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | Cc1cccc(CN2C(=O)/C(=C\c3ccc(C(=O)NCCCN4CCN(c5ccccc5F)CC4)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C37H37FN4O2S/c1-27-8-6-9-29(24-27)26-42-33-12-4-5-13-34(33)45-35(37(42)44)25-28-14-16-30(17-15-28)36(43)39-18-7-19-40-20-22-41(23-21-40)32-11-3-2-10-31(32)38/h2-6,8-17,24-25H,7,18-23,26H2,1H3,(H,39,43)/b35-25+ |
| InChIKey | GTJFLBZANNACIW-KVQDIILNSA-N |
| XLogP | 6.76 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|