C39H41N3O2S — CID 46374389
(2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 46374389) has the molecular formula C39H41N3O2S and a molecular weight of 615.84 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46374389 |
| Molecular Formula | C39H41N3O2S |
| Molecular Weight | 615.84 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | (2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(CN2C(=O)/C(=C/c3ccccc3)Sc3ccc(C(=O)NCCCN4CCC(Cc5ccccc5)CC4)cc32)c1 |
| InChI | InChI=1S/C39H41N3O2S/c1-29-10-8-15-33(24-29)28-42-35-27-34(16-17-36(35)45-37(39(42)44)26-31-13-6-3-7-14-31)38(43)40-20-9-21-41-22-18-32(19-23-41)25-30-11-4-2-5-12-30/h2-8,10-17,24,26-27,32H,9,18-23,25,28H2,1H3,(H,40,43)/b37-26- |
| InChIKey | WVSOIRKWHGSDBF-UOZKZNBHSA-N |
| XLogP | 7.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.84 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|