C31H33N3O2S — CID 46374318
(2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 46374318) has the molecular formula C31H33N3O2S and a molecular weight of 511.69 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46374318 |
| Molecular Formula | C31H33N3O2S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (2Z)-2-benzylidene-N-[3-(4-benzylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C1Nc2cc(C(=O)NCCCN3CCC(Cc4ccccc4)CC3)ccc2S/C1=C\c1ccccc1 |
| InChI | InChI=1S/C31H33N3O2S/c35-30(32-16-7-17-34-18-14-25(15-19-34)20-23-8-3-1-4-9-23)26-12-13-28-27(22-26)33-31(36)29(37-28)21-24-10-5-2-6-11-24/h1-6,8-13,21-22,25H,7,14-20H2,(H,32,35)(H,33,36)/b29-21- |
| InChIKey | MOCASBAAOYVBGK-ANYBSYGZSA-N |
| XLogP | 5.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|