C25H29N3O2S — CID 46373679
(2Z)-2-benzylidene-N-[3-(3-methylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 46373679) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[3-(3-methylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[3-(3-methylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46373679 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (2Z)-2-benzylidene-N-[3-(3-methylpiperidin-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)c2ccc3c(c2)NC(=O)/C(=C/c2ccccc2)S3)C1 |
| InChI | InChI=1S/C25H29N3O2S/c1-18-7-5-13-28(17-18)14-6-12-26-24(29)20-10-11-22-21(16-20)27-25(30)23(31-22)15-19-8-3-2-4-9-19/h2-4,8-11,15-16,18H,5-7,12-14,17H2,1H3,(H,26,29)(H,27,30)/b23-15- |
| InChIKey | NQKNTONXGRGXCG-HAHDFKILSA-N |
| XLogP | 4.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|