C31H34N4O2S — CID 3529954
2-benzylidene-N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 3529954) has the molecular formula C31H34N4O2S and a molecular weight of 526.71 g/mol. Its IUPAC name is 2-benzylidene-N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | 2-benzylidene-N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 3529954 |
| Molecular Formula | C31H34N4O2S |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 2-benzylidene-N-[3-[4-(2,5-dimethylphenyl)piperazin-1-yl]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1ccc(C)c(N2CCN(CCCNC(=O)c3ccc4c(c3)NC(=O)C(=Cc3ccccc3)S4)CC2)c1 |
| InChI | InChI=1S/C31H34N4O2S/c1-22-9-10-23(2)27(19-22)35-17-15-34(16-18-35)14-6-13-32-30(36)25-11-12-28-26(21-25)33-31(37)29(38-28)20-24-7-4-3-5-8-24/h3-5,7-12,19-21H,6,13-18H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | VXJTVZNYNYRBHP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|