C24H28N4O2S — CID 5045164
2-benzylidene-N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 5045164) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-benzylidene-N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | 2-benzylidene-N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 5045164 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-benzylidene-N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCN1CCN(CCNC(=O)c2ccc3c(c2)NC(=O)C(=Cc2ccccc2)S3)CC1 |
| InChI | InChI=1S/C24H28N4O2S/c1-2-27-12-14-28(15-13-27)11-10-25-23(29)19-8-9-21-20(17-19)26-24(30)22(31-21)16-18-6-4-3-5-7-18/h3-9,16-17H,2,10-15H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | QSSNJGSMXSIXKJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|