C25H32N4O2S+2 — CID 5124006
2-benzylidene-N-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 5124006) has the molecular formula C25H32N4O2S+2 and a molecular weight of 452.62 g/mol. Its IUPAC name is 2-benzylidene-N-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | 2-benzylidene-N-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 5124006 |
| Molecular Formula | C25H32N4O2S+2 |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-benzylidene-N-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CC[NH+]1CC[NH+](CCCNC(=O)c2ccc3c(c2)NC(=O)C(=Cc2ccccc2)S3)CC1 |
| InChI | InChI=1S/C25H30N4O2S/c1-2-28-13-15-29(16-14-28)12-6-11-26-24(30)20-9-10-22-21(18-20)27-25(31)23(32-22)17-19-7-4-3-5-8-19/h3-5,7-10,17-18H,2,6,11-16H2,1H3,(H,26,30)(H,27,31)/p+2 |
| InChIKey | ZTLHMWDMNVYRNZ-UHFFFAOYSA-P |
| XLogP | 0.70 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|