C23H25FN3O3S+ — CID 4100801
2-[(2-fluorophenyl)methylidene]-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 4100801) has the molecular formula C23H25FN3O3S+ and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylidene]-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | 2-[(2-fluorophenyl)methylidene]-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 4100801 |
| Molecular Formula | C23H25FN3O3S+ |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[(2-fluorophenyl)methylidene]-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C1Nc2cc(C(=O)NCCC[NH+]3CCOCC3)ccc2SC1=Cc1ccccc1F |
| InChI | InChI=1S/C23H24FN3O3S/c24-18-5-2-1-4-16(18)15-21-23(29)26-19-14-17(6-7-20(19)31-21)22(28)25-8-3-9-27-10-12-30-13-11-27/h1-2,4-7,14-15H,3,8-13H2,(H,25,28)(H,26,29)/p+1 |
| InChIKey | BFGRQJGJVLZCAD-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|