C24H17FN2O4S — CID 4092336
N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 4092336) has the molecular formula C24H17FN2O4S and a molecular weight of 448.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 4092336 |
| Molecular Formula | C24H17FN2O4S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C1Nc2cc(C(=O)NCc3ccc4c(c3)OCO4)ccc2SC1=Cc1ccccc1F |
| InChI | InChI=1S/C24H17FN2O4S/c25-17-4-2-1-3-15(17)11-22-24(29)27-18-10-16(6-8-21(18)32-22)23(28)26-12-14-5-7-19-20(9-14)31-13-30-19/h1-11H,12-13H2,(H,26,28)(H,27,29) |
| InChIKey | JFECVYJQNNKUJG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|