C23H26FN3O2S — CID 6010077
(2E)-N-[3-(diethylamino)propyl]-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 6010077) has the molecular formula C23H26FN3O2S and a molecular weight of 427.55 g/mol. Its IUPAC name is (2E)-N-[3-(diethylamino)propyl]-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-[3-(diethylamino)propyl]-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6010077 |
| Molecular Formula | C23H26FN3O2S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (2E)-N-[3-(diethylamino)propyl]-2-[(2-fluorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1ccccc1F)S2 |
| InChI | InChI=1S/C23H26FN3O2S/c1-3-27(4-2)13-7-12-25-22(28)17-10-11-20-19(14-17)26-23(29)21(30-20)15-16-8-5-6-9-18(16)24/h5-6,8-11,14-15H,3-4,7,12-13H2,1-2H3,(H,25,28)(H,26,29)/b21-15+ |
| InChIKey | KDHARUYXMZCVFO-RCCKNPSSSA-N |
| XLogP | 4.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|