C24H28ClN3O2S — CID 6069942
(2E)-2-[(2-chlorophenyl)methylidene]-N-[3-[ethyl(propyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 6069942) has the molecular formula C24H28ClN3O2S and a molecular weight of 458.03 g/mol. Its IUPAC name is (2E)-2-[(2-chlorophenyl)methylidene]-N-[3-[ethyl(propyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-2-[(2-chlorophenyl)methylidene]-N-[3-[ethyl(propyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6069942 |
| Molecular Formula | C24H28ClN3O2S |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2E)-2-[(2-chlorophenyl)methylidene]-N-[3-[ethyl(propyl)amino]propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCCN(CC)CCCNC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1ccccc1Cl)S2 |
| InChI | InChI=1S/C24H28ClN3O2S/c1-3-13-28(4-2)14-7-12-26-23(29)18-10-11-21-20(15-18)27-24(30)22(31-21)16-17-8-5-6-9-19(17)25/h5-6,8-11,15-16H,3-4,7,12-14H2,1-2H3,(H,26,29)(H,27,30)/b22-16+ |
| InChIKey | MXAAYOABDRXJHB-CJLVFECKSA-N |
| XLogP | 5.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|