C23H16Cl2N2O2S — CID 46373944
(2E)-N-[(2-chlorophenyl)methyl]-2-[(2-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 46373944) has the molecular formula C23H16Cl2N2O2S and a molecular weight of 455.37 g/mol. Its IUPAC name is (2E)-N-[(2-chlorophenyl)methyl]-2-[(2-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-[(2-chlorophenyl)methyl]-2-[(2-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46373944 |
| Molecular Formula | C23H16Cl2N2O2S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | (2E)-N-[(2-chlorophenyl)methyl]-2-[(2-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C1Nc2cc(C(=O)NCc3ccccc3Cl)ccc2S/C1=C/c1ccccc1Cl |
| InChI | InChI=1S/C23H16Cl2N2O2S/c24-17-7-3-1-5-14(17)12-21-23(29)27-19-11-15(9-10-20(19)30-21)22(28)26-13-16-6-2-4-8-18(16)25/h1-12H,13H2,(H,26,28)(H,27,29)/b21-12+ |
| InChIKey | MNFDYJMUHCJCLG-CIAFOILYSA-N |
| XLogP | 6.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|