C23H23ClN2O2S — CID 92697092
(2E)-2-[(2-chlorophenyl)methylidene]-N-[(1S,2S)-2-methylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 92697092) has the molecular formula C23H23ClN2O2S and a molecular weight of 426.97 g/mol. Its IUPAC name is (2E)-2-[(2-chlorophenyl)methylidene]-N-[(1S,2S)-2-methylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-2-[(2-chlorophenyl)methylidene]-N-[(1S,2S)-2-methylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92697092 |
| Molecular Formula | C23H23ClN2O2S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (2E)-2-[(2-chlorophenyl)methylidene]-N-[(1S,2S)-2-methylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1ccccc1Cl)S2 |
| InChI | InChI=1S/C23H23ClN2O2S/c1-14-6-2-5-9-18(14)25-22(27)16-10-11-20-19(12-16)26-23(28)21(29-20)13-15-7-3-4-8-17(15)24/h3-4,7-8,10-14,18H,2,5-6,9H2,1H3,(H,25,27)(H,26,28)/b21-13+/t14-,18-/m0/s1 |
| InChIKey | QTYWUYGCZNNOMK-KVDYQGCPSA-N |
| XLogP | 5.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|