C24H25ClN2O2S — CID 92697063
(2E)-2-[(3-chlorophenyl)methylidene]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 92697063) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is (2E)-2-[(3-chlorophenyl)methylidene]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-2-[(3-chlorophenyl)methylidene]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92697063 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (2E)-2-[(3-chlorophenyl)methylidene]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1cccc(Cl)c1)S2 |
| InChI | InChI=1S/C24H25ClN2O2S/c1-14-5-3-8-19(15(14)2)26-23(28)17-9-10-21-20(13-17)27-24(29)22(30-21)12-16-6-4-7-18(25)11-16/h4,6-7,9-15,19H,3,5,8H2,1-2H3,(H,26,28)(H,27,29)/b22-12+/t14-,15-,19+/m1/s1 |
| InChIKey | CYHBOQZJKSXEGD-RBDRBDEXSA-N |
| XLogP | 5.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|