C29H30FN4O2S+ — CID 3379541
N-[3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide (PubChem CID 3379541) has the molecular formula C29H30FN4O2S+ and a molecular weight of 517.65 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 3379541 |
| Molecular Formula | C29H30FN4O2S+ |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propyl]-4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzamide |
| SMILES | O=C1Nc2ccccc2SC1=Cc1ccc(C(=O)NCCC[NH+]2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H29FN4O2S/c30-23-10-12-24(13-11-23)34-18-16-33(17-19-34)15-3-14-31-28(35)22-8-6-21(7-9-22)20-27-29(36)32-25-4-1-2-5-26(25)37-27/h1-2,4-13,20H,3,14-19H2,(H,31,35)(H,32,36)/p+1 |
| InChIKey | DPLMFLOSKNTLPO-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|