C29H32N3O2S+ — CID 4114903
benzyl-[3-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]propyl]-propan-2-ylazanium (PubChem CID 4114903) has the molecular formula C29H32N3O2S+ and a molecular weight of 486.66 g/mol. Its IUPAC name is benzyl-[3-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]propyl]-propan-2-ylazanium.
| Compound Name | benzyl-[3-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]propyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 4114903 |
| Molecular Formula | C29H32N3O2S+ |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | benzyl-[3-[[4-[(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]benzoyl]amino]propyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH+](CCCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H31N3O2S/c1-21(2)32(20-23-9-4-3-5-10-23)18-8-17-30-28(33)24-15-13-22(14-16-24)19-27-29(34)31-25-11-6-7-12-26(25)35-27/h3-7,9-16,19,21H,8,17-18,20H2,1-2H3,(H,30,33)(H,31,34)/p+1 |
| InChIKey | KOGHRFXNGHWYOR-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|