C26H22FN3O2S — CID 4275079
2-[[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 4275079) has the molecular formula C26H22FN3O2S and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4275079 |
| Molecular Formula | C26H22FN3O2S |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2SC1=Cc1ccc(C(=O)N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C26H22FN3O2S/c27-20-5-1-3-7-22(20)29-13-15-30(16-14-29)26(32)19-11-9-18(10-12-19)17-24-25(31)28-21-6-2-4-8-23(21)33-24/h1-12,17H,13-16H2,(H,28,31) |
| InChIKey | GBQFFVHTQNTKBQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|