C25H22N4O2S — CID 24792851
(2Z)-2-benzylidene-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one (PubChem CID 24792851) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is (2Z)-2-benzylidene-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-benzylidene-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 24792851 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (2Z)-2-benzylidene-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2cc(C(=O)N3CCN(c4ccccn4)CC3)ccc2S/C1=C\c1ccccc1 |
| InChI | InChI=1S/C25H22N4O2S/c30-24-22(16-18-6-2-1-3-7-18)32-21-10-9-19(17-20(21)27-24)25(31)29-14-12-28(13-15-29)23-8-4-5-11-26-23/h1-11,16-17H,12-15H2,(H,27,30)/b22-16- |
| InChIKey | OKFLRVCGVBLCQO-JWGURIENSA-N |
| XLogP | 4.13 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|